This is the original version (as it was originally made). This item of legislation is currently only available in its original format.
Regulation 2(2)
| 1680 | Tetrafluoroethylene | 116-14-3 | 204-126-9 |
| 1681 | 6,6'-di-tert-butyl-2,2'-methylenedi-p-cresol; [DBMC] | 119-47-1 | 204-327-1 |
| 1682 | (5-chloro-2-methoxy-4-methyl-3-pyridyl)(4,5,6-trimethoxy-o-tolyl)methanone; pyriofenone | 688046-61-9 | 692-456-8 |
| 1683 | (RS)-1-{1-ethyl-4-[4-mesyl-3-(2-methoxyethoxy)-o-toluoyl]pyrazol-5-yloxy}ethyl methyl carbonate; tolpyralate | 1101132-67-5 | |
| 1684 | 3-methylpyrazole | 1453-58-3 | 215-925-7 |
| 1685 | N-methoxy-N-[1-methyl-2-(2,4,6-trichlorophenyl)-ethyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide; Pydiflumetofen | 1228284-64-7 | |
| 1686 | N-{2-[[1,1'-bi(cyclopropyl)]-2-yl]phenyl}- 3-(difluoromethyl)-1-methyl-1Hpyrazole-4-carboxamide; Sedaxane | 874967-67-6 | |
| 1687 | Thiophanate-methyl (ISO); dimethyl (1,2- phenylenedicarbamothioyl)biscarbamat; dimethyl 4,4’-(o-phenylene)bis(3- thioallophanate) | 23564-05-8 | 245-740-7 |
| 1688 | Mancozeb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) complex with zinc salt | 8018-01-7 | |
| 1689 | Trinickel disulfide; nickel subsulfide; [1] heazlewoodite [2] | 12035-72-2 [1] 12035-71-1 [2] | 234-829-6 [1] – [2] |
| 1690 | 7-oxa-3-oxiranylbicyclo[4.1.0]heptane; 1,2-epoxy-4-epoxyethylcyclohexane; 4-vinylcyclohexene diepoxide | 106-87-6 | 203-437-7 |
| 1691 | 4-methylpentan-2-one; isobutyl methyl ketone (MIBK) | 108-10-1 | 203-550-1 |
| 1692 | Carbendazim (ISO); methyl benzimidazole-2-ylcarbamat | 10605-21-7 | 234-232-0 |
| 1693 | Dimethomorph (ISO); (E,Z)-4-(3-(4- chlorophenyl)-3-(3,4- dimethoxyphenyl)acryloyl)morpholine | 110488-70-5; (1135441-72-3) | 404-200-2 |
| 1694 | 1,2,4-triazole | 288-88-0 | 206-022-9 |
| 1695 | Flumioxazin (ISO); N-(7-fluoro-3,4- dihydro-3-oxo-4-prop-2-ynyl-2H-1,4- benzoxazin-6-yl)cyclohex-1-ene-1,2- dicarboximide | 103361-09-7 | |
| 1696 | Imazamox (ISO); (RS)-2-(4-isopropyl-4- methyl- 5-oxo-2-imidazolin-2-yl)-5- methoxymethylnicotinic acid | 114311-32-9 | |
| 1697 | Thiamethoxam (ISO); 3-(2-chloro-thiazol-5-ylmethyl)-5- methyl[1,3,5]oxadiazinan-4-ylidene-N-nitroamine | 153719-23-4 | 428-650-4 |
| 1698 | Triticonazole (ISO); (RS)-(E)-5-(4- chlorobenzylidene)-2,2-dimethyl-1-(1H1,2,4-triazol-1-ylmethyl)cyclopentanol | 138182-18-0 | |
| 1699 | Desmedipham (ISO); ethyl 3-phenylcarbamoyloxyphenylcarbamate | 13684-56-5 | 237-198-5 |
| 1700 | Tellurium dioxide | 7446-07-3 | 231-193-1 |
| 1701 | Tellurium | 13494-80-9 | 236-813-4 |
| 1702 | Fluopicolide (ISO); 2,6-dichloro-N-[3-chloro-5- (trifluoromethyl)-2- pyridylmethyl]benzamide | 239110-15-7 | 607-285-6 |
| 1703 | Daminozide (ISO); 4-(2,2- dimethylhydrazino)-4-oxobutanoic acid; N-dimethylaminosuccinamic acid | 1596-84-5 | 216-485-9 |
| 1704 | Benzophenone | 119-61-9 | 204-337-6 |
| 1705 | Acetamiprid (ISO); (1E)-N-[(6- chloropyridin-3- yl)methyl]-N'-cyano-N-methylethanimidamide; (E)-N 1 -[(6- chloro-3-pyridyl)methyl]-N 2 -cyano-N 1 – methylacetamidine | 135410-20-7 | 603-921-1 |
| 1706 | Theophylline; 1,3-dimethyl-3,7-dihydro-1 H-purine-2,6-dione | 58-55-9 | 200-385-7 |
| 1707 | N-(2-nitrophenyl)phosphoric triamide | 874819-71-3 | 477-690-9 |
| 1708 | Dibutyltin di(acetate) | 1067-33-0 | 213-928-8 |
| 1709 | Dibutyltin bis(2-ethylhexanoate) | 2781-10-4 | 220-481-2 |
| 1710 | Cumene | 98-82-8 | 202-704-5 |
| 1711 | Barium diboron tetraoxide | 13701-59-2 | 237-222-4 |
| 1712 | 2-ethyl-2-[[(1-oxoallyl)oxy]methyl]-1,3- propanediyldiacrylate; 2,2- bis(acryloyloxymethyl)butyl acrylate; trimethylolpropane triacrylate | 15625-89-5 | 239-701-3 |
| 1713 | Quinoclamine (ISO); 2-amino-3-chloro-1,4-naphthoquinone | 2797-51-5 | 220-529-2 |
| 1714 | Pendimethalin (ISO); N-(1-ethylpropyl)- 2,6-dinitro-3,4-xylidene | 40487-42-1 | 254-938-2 |
| 1715 | Isoflucypram (ISO); N-(5-chloro-2-isopropylbenzyl)-N-cyclopropyl-3-(difluoromethyl)-5-fluoro-1-methyl-1H-pyrazole-4-carboxamide | 1255734-28-1 | |
| 1716 | Dimoxystrobin (ISO); (2E)-2-{2-[(2,5- dimethylphenoxy)methyl]phenyl}-2- (methoxyimino)-N-methylacetamide; (E)-2- (methoxyimino)-N-methyl-2-[a-(2,5-xylyloxy)-o-tolyl]acetamide | 149961-52-4 | 604-712-8 |
| 1717 | 2,2-dimethylpropan-1-ol, tribromo derivative; 3-bromo-2,2- bis(bromomethyl)propan-1-ol | 36483-57-5; 1522-92-5 | 253-057-0 |
| 1718 | 2,4,6-tri-tert-butylphenol | 732-26-3 | 211-989-5 |
| 1719 | Ammonium bromide | 12124-97-9 | 235-183-8 |
| 1720 | Divanadium pentaoxide; Vanadium pentoxide | 1314-62-1 | 215-239-8 |
| 1721 | Bentazone (ISO); 3-isopropyl-2,1,3- benzothiadiazine-4-one-2,2-dioxide | 25057-89-0 | 246-585-8 |
| 1722 | Margosa extract. [from the kernels of Azadirachta indica extracted with water and further processed with organic solvents] | 84696-25-3 | 283-644-7 |
| 1723 | Valifenalate (ISO); methyl N-(isopropoxycarbonyl)-L-valyl- (3RS)-3- (4-chlorophenyl)-β-alaninate | 283159-90-0 | |
| 1724 | Isopyrazam (ISO); reaction mass of 3-(difluoromethyl)-1-methyl-N- [(1RS,4SR,9RS)-1,2,3,4-tetrahydro-9-isopropyl-1,4- methanonaphthalen-5-yl]pyrazole-4-carboxamide and 3-(difluoromethyl)-1-methyl-N-[(1RS,4SR,9SR)-1,2,3,4- tetrahydro-9-isopropyl-1,4-methanonaphthalen-5- yl]pyrazole-4-carboxamide [>78% syn isomers ≤ 15% anti isomers relative content]; | 881685-58-1 | |
| 1725 | Perfluoroheptanoic acid; tridecafluoroheptanoic acid | 375-85-9 | 206-798-9 |
| 1726 | 4,4’-sulphonyldiphenol; bisphenol S | 80-09-1 | 201-250-5 |
| 1727 | 6-[C10-C13)-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid (tetra-PSCA) | 2156592-54-8 | 701-118-1 |
| 1728 | 6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid (Penta-PSCA) | 701-162-1 | |
| 1729 | [C12-18-alkyl-(branched, unsaturated)- 2,5-dioxopyrrolidin-1-yl] hexanoic acid, sodium and tris(2-hydroxyethyl) ammonium salts; (penta-PSCA Na-TEA) | 701-271-4 | |
| 1730 | 1,3,5-triazine-2,4,6-triamine; melamine | 108-78-1 | 203-615-4 |
| 1731 | Benzyl(diethylamino)diphenylphosphonium 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenolate | 577705-90-9 | 479-100-5 |
| 1732 | Benzyltriphenylphosphonium, salt with 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[phenol] (1:1) | 75768-65-9 | 278-305-5 |
| 1733 | Reaction mass of 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol and benzyl(diethylamino)diphenylphosphonium 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenolate (1:1) | ||
| 1734 | Reaction mass of 4,4'-[2,2,2-trifluoro 1-(trifluoromethyl)ethylidene] diphenol and benzyltriphenylphosphonium, salt with 4,4'-[2,2,2-trifluoro-1- (trifluoromethyl)ethylidene]bis[phenol] (1:1) | ||
| 1735 | Reaction mass of 1-(2,3-epoxypropoxy)-2,2-bis ((2,3-epoxypropoxy)methyl) butane and 1-(2,3-epoxypropoxy)-2- ((2,3-epoxypropoxy)methyl) -2-hydroxymethyl butane | ||
| 1736 | 4,4'-[2,2,2-trifluoro-1- (trifluoromethyl)ethylidene]diphenol; bisphenol AF | 1478-61-1 | 216-036-7 |
| 1737 | Transfluthrin (ISO); 2,3,5,6-tetrafluorobenzyl trans-2-(2,2-dichlorovinyl)-3,3-dimethylcyclopropanecarboxylate | 118712-89-3 | 405-060-5 |
| 1738 | Salts of 2-ethylhexanoic acid | ||
| 1739 | Benfluralin (ISO); N-butyl-N-ethyl-α,α,α-trifluoro-2,6-dinitro-p-toluidine | 1861-40-1 | 217-465-2 |
| 1740 | N,N-dimethyl-p-toluidine | 99-97-8 | 202-805-4 |
| 1741 | 4-nitrosomorpholine | 59-89-2 | |
| 1742 | 3,3'-dimethylbiphenyl 4,4'-diyl diisocyanate | 91-97-4 | 202-112-7 |
| 1743 | Foramsulfuron (ISO); 2-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-4-formamido-N,N dimethylbenzamide; 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-dimethylcarbamoyl-5-formamidophenylsulfonyl)urea | 173159-57-4 |
Regulation 2(3)
| 323 | 5-hydroxy-2-(hydroxymethyl)pyran-4-one | Kojic acid | 501-30-4 | 207-922-4 | Face and hand products | 1% |
All content is available under the Open Government Licence v3.0 except where otherwise stated. This site additionally contains content derived from EUR-Lex, reused under the terms of the Commission Decision 2011/833/EU on the reuse of documents from the EU institutions. For more information see the EUR-Lex public statement on re-use.
